C23H18F3N3O4 — CID 143657265
7'a-methyl-1'-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[6,7-dihydrofuro[3,2-f]indolizine-8,3'-7H-pyrrolo[3,2-b]pyridine]-2',4-dione (PubChem CID 143657265) has the molecular formula C23H18F3N3O4 and a molecular weight of 457.41 g/mol. Its IUPAC name is 7'a-methyl-1'-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[6,7-dihydrofuro[3,2-f]indolizine-8,3'-7H-pyrrolo[3,2-b]pyridine]-2',4-dione.
| Compound Name | 7'a-methyl-1'-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[6,7-dihydrofuro[3,2-f]indolizine-8,3'-7H-pyrrolo[3,2-b]pyridine]-2',4-dione |
|---|---|
| PubChem CID | 143657265 |
| Molecular Formula | C23H18F3N3O4 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 7'a-methyl-1'-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[6,7-dihydrofuro[3,2-f]indolizine-8,3'-7H-pyrrolo[3,2-b]pyridine]-2',4-dione |
| SMILES | CC12CC=CN=C1C1(CCn3c1cc1occc1c3=O)C(=O)N2Cc1ccc(C(F)(F)F)o1 |
| InChI | InChI=1S/C23H18F3N3O4/c1-21-6-2-8-27-19(21)22(7-9-28-16(22)11-15-14(18(28)30)5-10-32-15)20(31)29(21)12-13-3-4-17(33-13)23(24,25)26/h2-5,8,10-11H,6-7,9,12H2,1H3 |
| InChIKey | OESSRWNDVZSFTD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |