C18H21N3O3S — CID 143657471
5-methoxy-1'-pentylspiro[2H-furo[3,2-b]pyridine-3,3'-[1,2]thiazolo[3,4-b]pyridine] 2'-oxide (PubChem CID 143657471) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 5-methoxy-1'-pentylspiro[2H-furo[3,2-b]pyridine-3,3'-[1,2]thiazolo[3,4-b]pyridine] 2'-oxide.
| Compound Name | 5-methoxy-1'-pentylspiro[2H-furo[3,2-b]pyridine-3,3'-[1,2]thiazolo[3,4-b]pyridine] 2'-oxide |
|---|---|
| PubChem CID | 143657471 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 5-methoxy-1'-pentylspiro[2H-furo[3,2-b]pyridine-3,3'-[1,2]thiazolo[3,4-b]pyridine] 2'-oxide |
| SMILES | CCCCCN1c2ncccc2C2(COc3ccc(OC)nc32)S1=O |
| InChI | InChI=1S/C18H21N3O3S/c1-3-4-5-11-21-17-13(7-6-10-19-17)18(25(21)22)12-24-14-8-9-15(23-2)20-16(14)18/h6-10H,3-5,11-12H2,1-2H3 |
| InChIKey | XHCTVWJIPQJGMC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|