About 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine
2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine (PubChem CID 143657585) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine |
| PubChem CID | 143657585 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine |
| SMILES | CNC.O=C(CC1=CCCC=C1)NC=S |
| InChI | InChI=1S/C9H11NOS.C2H7N/c11-9(10-7-12)6-8-4-2-1-3-5-8;1-3-2/h2,4-5,7H,1,3,6H2,(H,10,11,12);3H,1-2H3 |
| InChIKey | IMOMGGOWRLZXCT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine?
The IUPAC name of 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine (CID 143657585) is 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine is CNC.O=C(CC1=CCCC=C1)NC=S.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine?
The InChIKey is IMOMGGOWRLZXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS.C2H7N/c11-9(10-7-12)6-8-4-2-1-3-5-8;1-3-2/h2,4-5,7H,1,3,6H2,(H,10,11,12);3H,1-2H3.
What are the key properties of 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine?
2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine has a molecular weight of 226.34 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-yl-N-methanethioylacetamide;N-methylmethanamine is sourced from PubChem (CID 143657585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).