C18H33NO — CID 143658127
N-cyclohexylformamide;(1R,5S,6S)-2-methyl-5-propan-2-ylbicyclo[4.1.0]heptane (PubChem CID 143658127) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is N-cyclohexylformamide;(1R,5S,6S)-2-methyl-5-propan-2-ylbicyclo[4.1.0]heptane.
| Compound Name | N-cyclohexylformamide;(1R,5S,6S)-2-methyl-5-propan-2-ylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 143658127 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | N-cyclohexylformamide;(1R,5S,6S)-2-methyl-5-propan-2-ylbicyclo[4.1.0]heptane |
| SMILES | CC1CC[C@@H](C(C)C)[C@@H]2C[C@H]12.O=CNC1CCCCC1 |
| InChI | InChI=1S/C11H20.C7H13NO/c1-7(2)9-5-4-8(3)10-6-11(9)10;9-6-8-7-4-2-1-3-5-7/h7-11H,4-6H2,1-3H3;6-7H,1-5H2,(H,8,9)/t8?,9-,10+,11-;/m0./s1 |
| InChIKey | OMLSLSGIGXIGTJ-YTIXYRQKSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|