About 2,5-dimethyl-1H-pyrazol-3-one;ethane
2,5-dimethyl-1H-pyrazol-3-one;ethane (PubChem CID 143658196) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2,5-dimethyl-1H-pyrazol-3-one;ethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-pyrazol-3-one;ethane |
| PubChem CID | 143658196 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2,5-dimethyl-1H-pyrazol-3-one;ethane |
| SMILES | CC.Cc1cc(=O)n(C)[nH]1 |
| InChI | InChI=1S/C5H8N2O.C2H6/c1-4-3-5(8)7(2)6-4;1-2/h3,6H,1-2H3;1-2H3 |
| InChIKey | FMXLKUVZNSMVEY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1H-pyrazol-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-pyrazol-3-one;ethane?
The IUPAC name of 2,5-dimethyl-1H-pyrazol-3-one;ethane (CID 143658196) is 2,5-dimethyl-1H-pyrazol-3-one;ethane.
What is the SMILES notation for 2,5-dimethyl-1H-pyrazol-3-one;ethane?
The canonical SMILES for 2,5-dimethyl-1H-pyrazol-3-one;ethane is CC.Cc1cc(=O)n(C)[nH]1.
What is the InChIKey of 2,5-dimethyl-1H-pyrazol-3-one;ethane?
The InChIKey is FMXLKUVZNSMVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.C2H6/c1-4-3-5(8)7(2)6-4;1-2/h3,6H,1-2H3;1-2H3.
What are the key properties of 2,5-dimethyl-1H-pyrazol-3-one;ethane?
2,5-dimethyl-1H-pyrazol-3-one;ethane has a molecular weight of 142.20 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-pyrazol-3-one;ethane is sourced from PubChem (CID 143658196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).