C22H38O3 — CID 143658966
(3R,7R,9S,10S,12S,14S)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol (PubChem CID 143658966) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (3R,7R,9S,10S,12S,14S)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol.
| Compound Name | (3R,7R,9S,10S,12S,14S)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
|---|---|
| PubChem CID | 143658966 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (3R,7R,9S,10S,12S,14S)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| SMILES | CC(C)C1CC[C@H]2C3C(O)CC4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)C12C |
| InChI | InChI=1S/C22H38O3/c1-12(2)15-5-6-16-20-17(11-19(25)22(15,16)4)21(3)8-7-14(23)9-13(21)10-18(20)24/h12-20,23-25H,5-11H2,1-4H3/t13?,14-,15?,16+,17+,18?,19+,20?,21+,22?/m1/s1 |
| InChIKey | RVGLYZXDVPTHGO-YDIABNNNSA-N |
| XLogP | 3.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |