About (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine
(2S)-2-cyclohexa-1,5-dien-1-ylmorpholine (PubChem CID 143659406) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine.
Molecular Properties
| Compound Name | (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine |
| PubChem CID | 143659406 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine |
| SMILES | C1=CC([C@H]2CNCCO2)=CCC1 |
| InChI | InChI=1S/C10H15NO/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h2,4-5,10-11H,1,3,6-8H2/t10-/m1/s1 |
| InChIKey | HUPIYDFEOOSZMP-SNVBAGLBSA-N |
| XLogP | 1.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine?
The IUPAC name of (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine (CID 143659406) is (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine.
What is the SMILES notation for (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine?
The canonical SMILES for (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine is C1=CC([C@H]2CNCCO2)=CCC1.
What is the InChIKey of (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine?
The InChIKey is HUPIYDFEOOSZMP-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h2,4-5,10-11H,1,3,6-8H2/t10-/m1/s1.
What are the key properties of (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine?
(2S)-2-cyclohexa-1,5-dien-1-ylmorpholine has a molecular weight of 165.24 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-cyclohexa-1,5-dien-1-ylmorpholine is sourced from PubChem (CID 143659406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).