C12H16N2O2 — CID 143660640
N-(5-hydroxy-1-methyl-2,3,4,5-tetrahydro-1-benzazepin-9-yl)formamide (PubChem CID 143660640) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(5-hydroxy-1-methyl-2,3,4,5-tetrahydro-1-benzazepin-9-yl)formamide.
| Compound Name | N-(5-hydroxy-1-methyl-2,3,4,5-tetrahydro-1-benzazepin-9-yl)formamide |
|---|---|
| PubChem CID | 143660640 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(5-hydroxy-1-methyl-2,3,4,5-tetrahydro-1-benzazepin-9-yl)formamide |
| SMILES | CN1CCCC(O)c2cccc(NC=O)c21 |
| InChI | InChI=1S/C12H16N2O2/c1-14-7-3-6-11(16)9-4-2-5-10(12(9)14)13-8-15/h2,4-5,8,11,16H,3,6-7H2,1H3,(H,13,15) |
| InChIKey | WTBVWAHVIIPCAG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|