About (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane
(Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane (PubChem CID 143660707) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane.
Molecular Properties
| Compound Name | (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane |
| PubChem CID | 143660707 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane |
| SMILES | C/C=C\C(=N/C)N(CC)CCCC.CCC |
| InChI | InChI=1S/C11H22N2.C3H8/c1-5-8-10-13(7-3)11(12-4)9-6-2;1-3-2/h6,9H,5,7-8,10H2,1-4H3;3H2,1-2H3/b9-6-,12-11+; |
| InChIKey | GGERKKBBFANZPS-JRXBEQJLSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane?
The IUPAC name of (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane (CID 143660707) is (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane.
What is the SMILES notation for (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane?
The canonical SMILES for (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane is C/C=C\C(=N/C)N(CC)CCCC.CCC.
What is the InChIKey of (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane?
The InChIKey is GGERKKBBFANZPS-JRXBEQJLSA-N. The full InChI is InChI=1S/C11H22N2.C3H8/c1-5-8-10-13(7-3)11(12-4)9-6-2;1-3-2/h6,9H,5,7-8,10H2,1-4H3;3H2,1-2H3/b9-6-,12-11+;.
What are the key properties of (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane?
(Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane has a molecular weight of 226.41 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-butyl-N-ethyl-N'-methylbut-2-enimidamide;propane is sourced from PubChem (CID 143660707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).