About 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane
2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane (PubChem CID 143660749) has the molecular formula C16H34NP
and a molecular weight of 271.43 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane |
| PubChem CID | 143660749 |
| Molecular Formula | C16H34NP |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane |
| SMILES | CC.CC.CC.CP.Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C9H11N.3C2H6.CH5P/c10-9-6-2-4-7-3-1-5-8(7)9;4*1-2/h2,4,6H,1,3,5,10H2;3*1-2H3;2H2,1H3 |
| InChIKey | DIVDIPRSQNNYIC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane?
The IUPAC name of 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane (CID 143660749) is 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane.
What is the SMILES notation for 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane?
The canonical SMILES for 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane is CC.CC.CC.CP.Nc1cccc2c1CCC2.
What is the InChIKey of 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane?
The InChIKey is DIVDIPRSQNNYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.3C2H6.CH5P/c10-9-6-2-4-7-3-1-5-8(7)9;4*1-2/h2,4,6H,1,3,5,10H2;3*1-2H3;2H2,1H3.
What are the key properties of 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane?
2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane has a molecular weight of 271.43 g/mol, XLogP of 5.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-4-amine;ethane;methylphosphane is sourced from PubChem (CID 143660749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).