C22H23N5OS3 — CID 143660866
2-[[2-[5-(morpholin-4-ylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-1H-indol-7-yl]-thiophen-2-ylsulfanylamino]acetonitrile (PubChem CID 143660866) has the molecular formula C22H23N5OS3 and a molecular weight of 469.66 g/mol. Its IUPAC name is 2-[[2-[5-(morpholin-4-ylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-1H-indol-7-yl]-thiophen-2-ylsulfanylamino]acetonitrile.
| Compound Name | 2-[[2-[5-(morpholin-4-ylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-1H-indol-7-yl]-thiophen-2-ylsulfanylamino]acetonitrile |
|---|---|
| PubChem CID | 143660866 |
| Molecular Formula | C22H23N5OS3 |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-[[2-[5-(morpholin-4-ylmethyl)-4,5-dihydro-1,3-thiazol-2-yl]-1H-indol-7-yl]-thiophen-2-ylsulfanylamino]acetonitrile |
| SMILES | N#CCN(Sc1cccs1)c1cccc2cc(C3=NCC(CN4CCOCC4)S3)[nH]c12 |
| InChI | InChI=1S/C22H23N5OS3/c23-6-7-27(31-20-5-2-12-29-20)19-4-1-3-16-13-18(25-21(16)19)22-24-14-17(30-22)15-26-8-10-28-11-9-26/h1-5,12-13,17,25H,7-11,14-15H2 |
| InChIKey | WNIZUNXJOFXHRJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|