C22H30N4OS3 — CID 143660872
N,5-dimethyl-2-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1H-indol-7-amine;morpholine;thiophene-2-thiol (PubChem CID 143660872) has the molecular formula C22H30N4OS3 and a molecular weight of 462.71 g/mol. Its IUPAC name is N,5-dimethyl-2-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1H-indol-7-amine;morpholine;thiophene-2-thiol.
| Compound Name | N,5-dimethyl-2-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1H-indol-7-amine;morpholine;thiophene-2-thiol |
|---|---|
| PubChem CID | 143660872 |
| Molecular Formula | C22H30N4OS3 |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N,5-dimethyl-2-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1H-indol-7-amine;morpholine;thiophene-2-thiol |
| SMILES | C1COCCN1.CNc1cc(C)cc2cc(C3=NCC(C)S3)[nH]c12.Sc1cccs1 |
| InChI | InChI=1S/C14H17N3S.C4H9NO.C4H4S2/c1-8-4-10-6-12(14-16-7-9(2)18-14)17-13(10)11(5-8)15-3;1-3-6-4-2-5-1;5-4-2-1-3-6-4/h4-6,9,15,17H,7H2,1-3H3;5H,1-4H2;1-3,5H |
| InChIKey | GSBAEALHCBRJOE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|