C32H47NO — CID 143661258
4-[4-[2-(2,3-dihydropyridin-3-yl)ethyl]phenyl]-3-[(1E,5E)-5-(2,2-dimethylpropyl)cyclonona-1,5-dien-1-yl]-3-methylbutan-1-ol (PubChem CID 143661258) has the molecular formula C32H47NO and a molecular weight of 461.73 g/mol. Its IUPAC name is 4-[4-[2-(2,3-dihydropyridin-3-yl)ethyl]phenyl]-3-[(1E,5E)-5-(2,2-dimethylpropyl)cyclonona-1,5-dien-1-yl]-3-methylbutan-1-ol.
| Compound Name | 4-[4-[2-(2,3-dihydropyridin-3-yl)ethyl]phenyl]-3-[(1E,5E)-5-(2,2-dimethylpropyl)cyclonona-1,5-dien-1-yl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 143661258 |
| Molecular Formula | C32H47NO |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.37 |
| IUPAC Name | 4-[4-[2-(2,3-dihydropyridin-3-yl)ethyl]phenyl]-3-[(1E,5E)-5-(2,2-dimethylpropyl)cyclonona-1,5-dien-1-yl]-3-methylbutan-1-ol |
| SMILES | CC(C)(C)C/C1=C/CCC/C(C(C)(CCO)Cc2ccc(CCC3C=CC=NC3)cc2)=C\CC1 |
| InChI | InChI=1S/C32H47NO/c1-31(2,3)23-27-9-5-6-12-30(13-7-10-27)32(4,20-22-34)24-28-17-14-26(15-18-28)16-19-29-11-8-21-33-25-29/h8-9,11,13-15,17-18,21,29,34H,5-7,10,12,16,19-20,22-25H2,1-4H3/b27-9+,30-13+ |
| InChIKey | HZYFATWAGBAZHZ-KTKRPCNFSA-N |
| XLogP | 8.06 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|