C9H10O2 — CID 143661885
2,3,6,7-tetrahydro-1aH-indeno[1,7a-b]oxiren-5-one (PubChem CID 143661885) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,3,6,7-tetrahydro-1aH-indeno[1,7a-b]oxiren-5-one.
| Compound Name | 2,3,6,7-tetrahydro-1aH-indeno[1,7a-b]oxiren-5-one |
|---|---|
| PubChem CID | 143661885 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2,3,6,7-tetrahydro-1aH-indeno[1,7a-b]oxiren-5-one |
| SMILES | O=C1C=C2CCC3OC23CC1 |
| InChI | InChI=1S/C9H10O2/c10-7-3-4-9-6(5-7)1-2-8(9)11-9/h5,8H,1-4H2 |
| InChIKey | RHOAPEGHZJJFSC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|