C25H39N3O2 — CID 143662423
N-[(3Z)-4-(1,7-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-3-yl)-5-methylhexa-1,3,5-trien-2-yl]-3-methylcyclohexane-1-carboxamide (PubChem CID 143662423) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is N-[(3Z)-4-(1,7-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-3-yl)-5-methylhexa-1,3,5-trien-2-yl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | N-[(3Z)-4-(1,7-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-3-yl)-5-methylhexa-1,3,5-trien-2-yl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143662423 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | N-[(3Z)-4-(1,7-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-3-yl)-5-methylhexa-1,3,5-trien-2-yl]-3-methylcyclohexane-1-carboxamide |
| SMILES | C=C(/C=C(\C(=C)C)C1CC2CNC(C)CC2N(C)C1=O)NC(=O)C1CCCC(C)C1 |
| InChI | InChI=1S/C25H39N3O2/c1-15(2)21(11-18(5)27-24(29)19-9-7-8-16(3)10-19)22-13-20-14-26-17(4)12-23(20)28(6)25(22)30/h11,16-17,19-20,22-23,26H,1,5,7-10,12-14H2,2-4,6H3,(H,27,29)/b21-11+ |
| InChIKey | PTJGXTXLIDPVKW-SRZZPIQSSA-N |
| XLogP | 3.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|