About (Z)-3-fluoro-N,2-dimethylpent-2-enamide
(Z)-3-fluoro-N,2-dimethylpent-2-enamide (PubChem CID 143662601) has the molecular formula C7H12FNO
and a molecular weight of 145.18 g/mol. Its IUPAC name is (Z)-3-fluoro-N,2-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | (Z)-3-fluoro-N,2-dimethylpent-2-enamide |
| PubChem CID | 143662601 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (Z)-3-fluoro-N,2-dimethylpent-2-enamide |
| SMILES | CC/C(F)=C(\C)C(=O)NC |
| InChI | InChI=1S/C7H12FNO/c1-4-6(8)5(2)7(10)9-3/h4H2,1-3H3,(H,9,10)/b6-5- |
| InChIKey | OGWGXXXZZPDVNE-WAYWQWQTSA-N |
| XLogP | 1.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-fluoro-N,2-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-fluoro-N,2-dimethylpent-2-enamide?
The IUPAC name of (Z)-3-fluoro-N,2-dimethylpent-2-enamide (CID 143662601) is (Z)-3-fluoro-N,2-dimethylpent-2-enamide.
What is the SMILES notation for (Z)-3-fluoro-N,2-dimethylpent-2-enamide?
The canonical SMILES for (Z)-3-fluoro-N,2-dimethylpent-2-enamide is CC/C(F)=C(\C)C(=O)NC.
What is the InChIKey of (Z)-3-fluoro-N,2-dimethylpent-2-enamide?
The InChIKey is OGWGXXXZZPDVNE-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H12FNO/c1-4-6(8)5(2)7(10)9-3/h4H2,1-3H3,(H,9,10)/b6-5-.
What are the key properties of (Z)-3-fluoro-N,2-dimethylpent-2-enamide?
(Z)-3-fluoro-N,2-dimethylpent-2-enamide has a molecular weight of 145.18 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-fluoro-N,2-dimethylpent-2-enamide is sourced from PubChem (CID 143662601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).