C22H18ClO3P — CID 14366299
(2-chloro-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 14366299) has the molecular formula C22H18ClO3P and a molecular weight of 396.81 g/mol. Its IUPAC name is (2-chloro-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (2-chloro-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 14366299 |
| Molecular Formula | C22H18ClO3P |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (2-chloro-6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P2(=O)Oc3ccc(Cl)cc3-c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H18ClO3P/c1-13-10-14(2)21(15(3)11-13)22(24)27(25)20-7-5-4-6-17(20)18-12-16(23)8-9-19(18)26-27/h4-12H,1-3H3 |
| InChIKey | LCIAUPIYRRCTRK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|