About ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine
ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine (PubChem CID 143662990) has the molecular formula C13H16F3N
and a molecular weight of 243.27 g/mol. Its IUPAC name is ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine.
Molecular Properties
| Compound Name | ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine |
| PubChem CID | 143662990 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine |
| SMILES | C=Cc1cc(C)c(C(F)(F)F)cc1N=C.CC |
| InChI | InChI=1S/C11H10F3N.C2H6/c1-4-8-5-7(2)9(11(12,13)14)6-10(8)15-3;1-2/h4-6H,1,3H2,2H3;1-2H3 |
| InChIKey | VHXIFJWGBNAIRB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine?
The IUPAC name of ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine (CID 143662990) is ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine.
What is the SMILES notation for ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine?
The canonical SMILES for ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine is C=Cc1cc(C)c(C(F)(F)F)cc1N=C.CC.
What is the InChIKey of ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine?
The InChIKey is VHXIFJWGBNAIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N.C2H6/c1-4-8-5-7(2)9(11(12,13)14)6-10(8)15-3;1-2/h4-6H,1,3H2,2H3;1-2H3.
What are the key properties of ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine?
ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine has a molecular weight of 243.27 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[2-ethenyl-4-methyl-5-(trifluoromethyl)phenyl]methanimine is sourced from PubChem (CID 143662990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).