C26H40N2 — CID 143663039
(4E)-1-(cycloheptylmethyl)-2-[(2E)-5-methylhexa-2,4-dien-2-yl]-4-(4-methylhex-3-enylidene)-5-methylideneimidazole (PubChem CID 143663039) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (4E)-1-(cycloheptylmethyl)-2-[(2E)-5-methylhexa-2,4-dien-2-yl]-4-(4-methylhex-3-enylidene)-5-methylideneimidazole.
| Compound Name | (4E)-1-(cycloheptylmethyl)-2-[(2E)-5-methylhexa-2,4-dien-2-yl]-4-(4-methylhex-3-enylidene)-5-methylideneimidazole |
|---|---|
| PubChem CID | 143663039 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | (4E)-1-(cycloheptylmethyl)-2-[(2E)-5-methylhexa-2,4-dien-2-yl]-4-(4-methylhex-3-enylidene)-5-methylideneimidazole |
| SMILES | C=c1/c(=C\CC=C(C)CC)nc(/C(C)=C/C=C(C)C)n1CC1CCCCCC1 |
| InChI | InChI=1S/C26H40N2/c1-7-21(4)13-12-16-25-23(6)28(19-24-14-10-8-9-11-15-24)26(27-25)22(5)18-17-20(2)3/h13,16-18,24H,6-12,14-15,19H2,1-5H3/b21-13?,22-18+,25-16+ |
| InChIKey | OSKRRSHIVWFUIL-JNEHCGCISA-N |
| XLogP | 6.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|