C26H29NO5 — CID 14366315
N-[4,8-dihydroxy-3,7-bis(2-methylpropyl)-9,10-dioxoanthracen-1-yl]-2-methylprop-2-enamide (PubChem CID 14366315) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[4,8-dihydroxy-3,7-bis(2-methylpropyl)-9,10-dioxoanthracen-1-yl]-2-methylprop-2-enamide.
| Compound Name | N-[4,8-dihydroxy-3,7-bis(2-methylpropyl)-9,10-dioxoanthracen-1-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 14366315 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[4,8-dihydroxy-3,7-bis(2-methylpropyl)-9,10-dioxoanthracen-1-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cc(CC(C)C)c(O)c2c1C(=O)c1c(ccc(CC(C)C)c1O)C2=O |
| InChI | InChI=1S/C26H29NO5/c1-12(2)9-15-7-8-17-19(22(15)28)25(31)20-18(27-26(32)14(5)6)11-16(10-13(3)4)23(29)21(20)24(17)30/h7-8,11-13,28-29H,5,9-10H2,1-4,6H3,(H,27,32) |
| InChIKey | VXCURHJIHGUHFF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|