C37H37F3N6O3 — CID 143663393
1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide (PubChem CID 143663393) has the molecular formula C37H37F3N6O3 and a molecular weight of 670.74 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide.
| Compound Name | 1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143663393 |
| Molecular Formula | C37H37F3N6O3 |
| Molecular Weight | 670.74 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | 1-[(2S)-1-amino-5-[(1-aminocyclopropyl)amino]-1-oxopentan-2-yl]-2-(3-phenylmethoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carboxamide |
| SMILES | NC(=O)[C@H](CCCNC1(N)CC1)n1c(-c2cccc(OCc3ccccc3)c2)nc2cc(C(=O)NCc3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C37H37F3N6O3/c38-37(39,40)28-11-4-9-25(19-28)22-43-35(48)27-14-15-31-30(21-27)45-34(46(31)32(33(41)47)13-6-18-44-36(42)16-17-36)26-10-5-12-29(20-26)49-23-24-7-2-1-3-8-24/h1-5,7-12,14-15,19-21,32,44H,6,13,16-18,22-23,42H2,(H2,41,47)(H,43,48)/t32-/m0/s1 |
| InChIKey | AMEZOXNEBXDIEN-YTTGMZPUSA-N |
| XLogP | 6.08 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|