C16H15F4NO4 — CID 143663570
4-(7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)-5-(trifluoromethyl)benzene-1,2-diol;methanamine (PubChem CID 143663570) has the molecular formula C16H15F4NO4 and a molecular weight of 361.29 g/mol. Its IUPAC name is 4-(7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)-5-(trifluoromethyl)benzene-1,2-diol;methanamine.
| Compound Name | 4-(7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)-5-(trifluoromethyl)benzene-1,2-diol;methanamine |
|---|---|
| PubChem CID | 143663570 |
| Molecular Formula | C16H15F4NO4 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-(7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)-5-(trifluoromethyl)benzene-1,2-diol;methanamine |
| SMILES | CN.Oc1cc(-c2cc(F)cc3c2OCCO3)c(C(F)(F)F)cc1O |
| InChI | InChI=1S/C15H10F4O4.CH5N/c16-7-3-9(14-13(4-7)22-1-2-23-14)8-5-11(20)12(21)6-10(8)15(17,18)19;1-2/h3-6,20-21H,1-2H2;2H2,1H3 |
| InChIKey | MYQHZVLCUBRDES-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|