About 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide
7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide (PubChem CID 143663593) has the molecular formula C18H17F4NO3
and a molecular weight of 371.33 g/mol. Its IUPAC name is 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide.
Molecular Properties
| Compound Name | 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide |
| PubChem CID | 143663593 |
| Molecular Formula | C18H17F4NO3 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide |
| SMILES | CNC(C)=O.Fc1cc2c(c(-c3ccccc3C(F)(F)F)c1)OCCO2 |
| InChI | InChI=1S/C15H10F4O2.C3H7NO/c16-9-7-11(14-13(8-9)20-5-6-21-14)10-3-1-2-4-12(10)15(17,18)19;1-3(5)4-2/h1-4,7-8H,5-6H2;1-2H3,(H,4,5) |
| InChIKey | IKZGIPWXRRZHSA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide?
The IUPAC name of 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide (CID 143663593) is 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide.
What is the SMILES notation for 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide?
The canonical SMILES for 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide is CNC(C)=O.Fc1cc2c(c(-c3ccccc3C(F)(F)F)c1)OCCO2.
What is the InChIKey of 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide?
The InChIKey is IKZGIPWXRRZHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F4O2.C3H7NO/c16-9-7-11(14-13(8-9)20-5-6-21-14)10-3-1-2-4-12(10)15(17,18)19;1-3(5)4-2/h1-4,7-8H,5-6H2;1-2H3,(H,4,5).
What are the key properties of 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide?
7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide has a molecular weight of 371.33 g/mol, XLogP of 4.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine;N-methylacetamide is sourced from PubChem (CID 143663593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).