About 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one
8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 143663627) has the molecular formula C15H10Cl2O2
and a molecular weight of 293.15 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 143663627 |
| Molecular Formula | C15H10Cl2O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2c1cccc2-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H10Cl2O2/c16-11-5-2-6-12(17)14(11)10-4-1-3-9-13(18)7-8-19-15(9)10/h1-6H,7-8H2 |
| InChIKey | RRNVFNUMKPZRON-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one?
The IUPAC name of 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one (CID 143663627) is 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one is O=C1CCOc2c1cccc2-c1c(Cl)cccc1Cl.
What is the InChIKey of 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one?
The InChIKey is RRNVFNUMKPZRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2O2/c16-11-5-2-6-12(17)14(11)10-4-1-3-9-13(18)7-8-19-15(9)10/h1-6H,7-8H2.
What are the key properties of 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one?
8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one has a molecular weight of 293.15 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,6-dichlorophenyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 143663627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).