C30H34F3N3O2 — CID 143663980
5-[3-methanimidoyl-4-(4-methylanilino)anilino]-8,8-dimethyl-2-propan-2-yl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol (PubChem CID 143663980) has the molecular formula C30H34F3N3O2 and a molecular weight of 525.62 g/mol. Its IUPAC name is 5-[3-methanimidoyl-4-(4-methylanilino)anilino]-8,8-dimethyl-2-propan-2-yl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol.
| Compound Name | 5-[3-methanimidoyl-4-(4-methylanilino)anilino]-8,8-dimethyl-2-propan-2-yl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol |
|---|---|
| PubChem CID | 143663980 |
| Molecular Formula | C30H34F3N3O2 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 5-[3-methanimidoyl-4-(4-methylanilino)anilino]-8,8-dimethyl-2-propan-2-yl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol |
| SMILES | [H]/N=C/c1cc(NC2c3ccc(C(C)C)c(O)c3C(C)(C)CC2(O)C(F)(F)F)ccc1Nc1ccc(C)cc1 |
| InChI | InChI=1S/C30H34F3N3O2/c1-17(2)22-11-12-23-25(26(22)37)28(4,5)16-29(38,30(31,32)33)27(23)36-21-10-13-24(19(14-21)15-34)35-20-8-6-18(3)7-9-20/h6-15,17,27,34-38H,16H2,1-5H3/b34-15+ |
| InChIKey | JWTRCZXHUGLRCD-PUHLOBNQSA-N |
| XLogP | 7.69 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|