About 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide
3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide (PubChem CID 143664094) has the molecular formula C12H14F2N4O
and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide |
| PubChem CID | 143664094 |
| Molecular Formula | C12H14F2N4O |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC2=CCCNC=C2)c(C(F)F)n1 |
| InChI | InChI=1S/C12H14F2N4O/c1-18-7-9(10(17-18)11(13)14)12(19)16-8-3-2-5-15-6-4-8/h3-4,6-7,11,15H,2,5H2,1H3,(H,16,19) |
| InChIKey | QQQJSVHWRAUHRO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide?
The IUPAC name of 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide (CID 143664094) is 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide.
What is the SMILES notation for 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide?
The canonical SMILES for 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide is Cn1cc(C(=O)NC2=CCCNC=C2)c(C(F)F)n1.
What is the InChIKey of 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide?
The InChIKey is QQQJSVHWRAUHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N4O/c1-18-7-9(10(17-18)11(13)14)12(19)16-8-3-2-5-15-6-4-8/h3-4,6-7,11,15H,2,5H2,1H3,(H,16,19).
What are the key properties of 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide?
3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide has a molecular weight of 268.27 g/mol, XLogP of 1.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-N-(2,3-dihydro-1H-azepin-5-yl)-1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 143664094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).