About 2,3-dihydro-1H-isoindole;propane
2,3-dihydro-1H-isoindole;propane (PubChem CID 143664117) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole;propane.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-isoindole;propane |
| PubChem CID | 143664117 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2,3-dihydro-1H-isoindole;propane |
| SMILES | CCC.c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C8H9N.C3H8/c1-2-4-8-6-9-5-7(8)3-1;1-3-2/h1-4,9H,5-6H2;3H2,1-2H3 |
| InChIKey | BCYJOFBFCJIPAX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydro-1H-isoindole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-isoindole;propane?
The IUPAC name of 2,3-dihydro-1H-isoindole;propane (CID 143664117) is 2,3-dihydro-1H-isoindole;propane.
What is the SMILES notation for 2,3-dihydro-1H-isoindole;propane?
The canonical SMILES for 2,3-dihydro-1H-isoindole;propane is CCC.c1ccc2c(c1)CNC2.
What is the InChIKey of 2,3-dihydro-1H-isoindole;propane?
The InChIKey is BCYJOFBFCJIPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C3H8/c1-2-4-8-6-9-5-7(8)3-1;1-3-2/h1-4,9H,5-6H2;3H2,1-2H3.
What are the key properties of 2,3-dihydro-1H-isoindole;propane?
2,3-dihydro-1H-isoindole;propane has a molecular weight of 163.26 g/mol, XLogP of 2.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindole;propane is sourced from PubChem (CID 143664117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).