C21H37N3OS — CID 143664451
6-[butyl(ethyl)amino]-N-hexan-3-yl-2-propan-2-ylsulfanylpyridine-3-carboxamide (PubChem CID 143664451) has the molecular formula C21H37N3OS and a molecular weight of 379.61 g/mol. Its IUPAC name is 6-[butyl(ethyl)amino]-N-hexan-3-yl-2-propan-2-ylsulfanylpyridine-3-carboxamide.
| Compound Name | 6-[butyl(ethyl)amino]-N-hexan-3-yl-2-propan-2-ylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 143664451 |
| Molecular Formula | C21H37N3OS |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 6-[butyl(ethyl)amino]-N-hexan-3-yl-2-propan-2-ylsulfanylpyridine-3-carboxamide |
| SMILES | CCCCN(CC)c1ccc(C(=O)NC(CC)CCC)c(SC(C)C)n1 |
| InChI | InChI=1S/C21H37N3OS/c1-7-11-15-24(10-4)19-14-13-18(21(23-19)26-16(5)6)20(25)22-17(9-3)12-8-2/h13-14,16-17H,7-12,15H2,1-6H3,(H,22,25) |
| InChIKey | FTQIPGXHWMJOGZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |