About (3S)-3-methyl-3,4-dihydropyrrol-2-one
(3S)-3-methyl-3,4-dihydropyrrol-2-one (PubChem CID 143664764) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is (3S)-3-methyl-3,4-dihydropyrrol-2-one.
Molecular Properties
| Compound Name | (3S)-3-methyl-3,4-dihydropyrrol-2-one |
| PubChem CID | 143664764 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | (3S)-3-methyl-3,4-dihydropyrrol-2-one |
| SMILES | C[C@H]1CC=NC1=O |
| InChI | InChI=1S/C5H7NO/c1-4-2-3-6-5(4)7/h3-4H,2H2,1H3/t4-/m0/s1 |
| InChIKey | NIKFVBKOVPGSJZ-BYPYZUCNSA-N |
| XLogP | 0.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-methyl-3,4-dihydropyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-3,4-dihydropyrrol-2-one?
The IUPAC name of (3S)-3-methyl-3,4-dihydropyrrol-2-one (CID 143664764) is (3S)-3-methyl-3,4-dihydropyrrol-2-one.
What is the SMILES notation for (3S)-3-methyl-3,4-dihydropyrrol-2-one?
The canonical SMILES for (3S)-3-methyl-3,4-dihydropyrrol-2-one is C[C@H]1CC=NC1=O.
What is the InChIKey of (3S)-3-methyl-3,4-dihydropyrrol-2-one?
The InChIKey is NIKFVBKOVPGSJZ-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H7NO/c1-4-2-3-6-5(4)7/h3-4H,2H2,1H3/t4-/m0/s1.
What are the key properties of (3S)-3-methyl-3,4-dihydropyrrol-2-one?
(3S)-3-methyl-3,4-dihydropyrrol-2-one has a molecular weight of 97.12 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-3,4-dihydropyrrol-2-one is sourced from PubChem (CID 143664764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).