About 4-amino-3-methylbenzaldehyde;butane;ethane
4-amino-3-methylbenzaldehyde;butane;ethane (PubChem CID 143664770) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-amino-3-methylbenzaldehyde;butane;ethane.
Molecular Properties
| Compound Name | 4-amino-3-methylbenzaldehyde;butane;ethane |
| PubChem CID | 143664770 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4-amino-3-methylbenzaldehyde;butane;ethane |
| SMILES | CC.CCCC.Cc1cc(C=O)ccc1N |
| InChI | InChI=1S/C8H9NO.C4H10.C2H6/c1-6-4-7(5-10)2-3-8(6)9;1-3-4-2;1-2/h2-5H,9H2,1H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | LFLMHZBPHBOPAA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-methylbenzaldehyde;butane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methylbenzaldehyde;butane;ethane?
The IUPAC name of 4-amino-3-methylbenzaldehyde;butane;ethane (CID 143664770) is 4-amino-3-methylbenzaldehyde;butane;ethane.
What is the SMILES notation for 4-amino-3-methylbenzaldehyde;butane;ethane?
The canonical SMILES for 4-amino-3-methylbenzaldehyde;butane;ethane is CC.CCCC.Cc1cc(C=O)ccc1N.
What is the InChIKey of 4-amino-3-methylbenzaldehyde;butane;ethane?
The InChIKey is LFLMHZBPHBOPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C4H10.C2H6/c1-6-4-7(5-10)2-3-8(6)9;1-3-4-2;1-2/h2-5H,9H2,1H3;3-4H2,1-2H3;1-2H3.
What are the key properties of 4-amino-3-methylbenzaldehyde;butane;ethane?
4-amino-3-methylbenzaldehyde;butane;ethane has a molecular weight of 223.36 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methylbenzaldehyde;butane;ethane is sourced from PubChem (CID 143664770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).