C10H10N2O — CID 143664951
(3E)-3-(aminomethylidene)-1,4-dihydroquinolin-2-one (PubChem CID 143664951) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is (3E)-3-(aminomethylidene)-1,4-dihydroquinolin-2-one.
| Compound Name | (3E)-3-(aminomethylidene)-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 143664951 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (3E)-3-(aminomethylidene)-1,4-dihydroquinolin-2-one |
| SMILES | N/C=C1\Cc2ccccc2NC1=O |
| InChI | InChI=1S/C10H10N2O/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13/h1-4,6H,5,11H2,(H,12,13)/b8-6+ |
| InChIKey | IMHDMZDAJYEVPY-SOFGYWHQSA-N |
| XLogP | 1.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|