C23H22N2O3S — CID 143665418
5-[[4-(6,8-dimethylquinolin-4-yl)oxy-2-ethylphenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 143665418) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 5-[[4-(6,8-dimethylquinolin-4-yl)oxy-2-ethylphenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(6,8-dimethylquinolin-4-yl)oxy-2-ethylphenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143665418 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-[[4-(6,8-dimethylquinolin-4-yl)oxy-2-ethylphenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cc(Oc2ccnc3c(C)cc(C)cc23)ccc1CC1SC(=O)NC1=O |
| InChI | InChI=1S/C23H22N2O3S/c1-4-15-11-17(6-5-16(15)12-20-22(26)25-23(27)29-20)28-19-7-8-24-21-14(3)9-13(2)10-18(19)21/h5-11,20H,4,12H2,1-3H3,(H,25,26,27) |
| InChIKey | LTVVKICFURLNDY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|