About methanamine;2-pyrrolidin-1-ylaniline
methanamine;2-pyrrolidin-1-ylaniline (PubChem CID 143665772) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is methanamine;2-pyrrolidin-1-ylaniline.
Molecular Properties
| Compound Name | methanamine;2-pyrrolidin-1-ylaniline |
| PubChem CID | 143665772 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | methanamine;2-pyrrolidin-1-ylaniline |
| SMILES | CN.Nc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C10H14N2.CH5N/c11-9-5-1-2-6-10(9)12-7-3-4-8-12;1-2/h1-2,5-6H,3-4,7-8,11H2;2H2,1H3 |
| InChIKey | ZSSKCFJLJCODAV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methanamine;2-pyrrolidin-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-pyrrolidin-1-ylaniline?
The IUPAC name of methanamine;2-pyrrolidin-1-ylaniline (CID 143665772) is methanamine;2-pyrrolidin-1-ylaniline.
What is the SMILES notation for methanamine;2-pyrrolidin-1-ylaniline?
The canonical SMILES for methanamine;2-pyrrolidin-1-ylaniline is CN.Nc1ccccc1N1CCCC1.
What is the InChIKey of methanamine;2-pyrrolidin-1-ylaniline?
The InChIKey is ZSSKCFJLJCODAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.CH5N/c11-9-5-1-2-6-10(9)12-7-3-4-8-12;1-2/h1-2,5-6H,3-4,7-8,11H2;2H2,1H3.
What are the key properties of methanamine;2-pyrrolidin-1-ylaniline?
methanamine;2-pyrrolidin-1-ylaniline has a molecular weight of 193.29 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-pyrrolidin-1-ylaniline is sourced from PubChem (CID 143665772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).