C27H34N6O3S — CID 143666042
N-[(2Z)-1-methylimino-3-piperazin-1-ylpenta-2,4-dien-2-yl]-2-(3-oxo-6-pentoxy-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 143666042) has the molecular formula C27H34N6O3S and a molecular weight of 522.68 g/mol. Its IUPAC name is N-[(2Z)-1-methylimino-3-piperazin-1-ylpenta-2,4-dien-2-yl]-2-(3-oxo-6-pentoxy-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2Z)-1-methylimino-3-piperazin-1-ylpenta-2,4-dien-2-yl]-2-(3-oxo-6-pentoxy-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 143666042 |
| Molecular Formula | C27H34N6O3S |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | N-[(2Z)-1-methylimino-3-piperazin-1-ylpenta-2,4-dien-2-yl]-2-(3-oxo-6-pentoxy-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C=C/C(=C(\C=N\C)NC(=O)c1csc(N2Cc3cc(OCCCCC)ccc3C2=O)n1)N1CCNCC1 |
| InChI | InChI=1S/C27H34N6O3S/c1-4-6-7-14-36-20-8-9-21-19(15-20)17-33(26(21)35)27-31-23(18-37-27)25(34)30-22(16-28-3)24(5-2)32-12-10-29-11-13-32/h5,8-9,15-16,18,29H,2,4,6-7,10-14,17H2,1,3H3,(H,30,34)/b24-22-,28-16+ |
| InChIKey | CGZPHGLTUXCAAK-QNFMJMEVSA-N |
| XLogP | 3.61 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|