C24H24N6O3S — CID 143666132
N-[4-[(3S)-3-ethenylpiperazin-1-yl]-3-pyridinyl]-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 143666132) has the molecular formula C24H24N6O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[4-[(3S)-3-ethenylpiperazin-1-yl]-3-pyridinyl]-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-[(3S)-3-ethenylpiperazin-1-yl]-3-pyridinyl]-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 143666132 |
| Molecular Formula | C24H24N6O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[4-[(3S)-3-ethenylpiperazin-1-yl]-3-pyridinyl]-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C=C[C@H]1CN(c2ccncc2NC(=O)c2csc(N3Cc4ccc(OC)cc4C3=O)n2)CCN1 |
| InChI | InChI=1S/C24H24N6O3S/c1-3-16-13-29(9-8-26-16)21-6-7-25-11-19(21)27-22(31)20-14-34-24(28-20)30-12-15-4-5-17(33-2)10-18(15)23(30)32/h3-7,10-11,14,16,26H,1,8-9,12-13H2,2H3,(H,27,31)/t16-/m0/s1 |
| InChIKey | LLNROOSVVXFLHA-INIZCTEOSA-N |
| XLogP | 2.92 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|