About 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol
3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol (PubChem CID 143666361) has the molecular formula C23H24ClN3O3
and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol.
Molecular Properties
| Compound Name | 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol |
| PubChem CID | 143666361 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol |
| SMILES | CCN(CCO)CCOc1ccc(-c2cccc(O)c2)c2c1[nH]c1ncc(Cl)cc12 |
| InChI | InChI=1S/C23H24ClN3O3/c1-2-27(8-10-28)9-11-30-20-7-6-18(15-4-3-5-17(29)12-15)21-19-13-16(24)14-25-23(19)26-22(20)21/h3-7,12-14,28-29H,2,8-11H2,1H3,(H,25,26) |
| InChIKey | WATQTWPTEWVXLX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol?
The IUPAC name of 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol (CID 143666361) is 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol.
What is the SMILES notation for 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol?
The canonical SMILES for 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol is CCN(CCO)CCOc1ccc(-c2cccc(O)c2)c2c1[nH]c1ncc(Cl)cc12.
What is the InChIKey of 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol?
The InChIKey is WATQTWPTEWVXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClN3O3/c1-2-27(8-10-28)9-11-30-20-7-6-18(15-4-3-5-17(29)12-15)21-19-13-16(24)14-25-23(19)26-22(20)21/h3-7,12-14,28-29H,2,8-11H2,1H3,(H,25,26).
What are the key properties of 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol?
3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol has a molecular weight of 425.92 g/mol, XLogP of 4.44, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-chloro-8-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]-9H-pyrido[2,3-b]indol-5-yl]phenol is sourced from PubChem (CID 143666361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).