C28H31F2N3O2S — CID 143666390
2-[3-[[5-(3-cyclopropylsulfanylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2-difluoroethanol (PubChem CID 143666390) has the molecular formula C28H31F2N3O2S and a molecular weight of 511.64 g/mol. Its IUPAC name is 2-[3-[[5-(3-cyclopropylsulfanylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2-difluoroethanol.
| Compound Name | 2-[3-[[5-(3-cyclopropylsulfanylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 143666390 |
| Molecular Formula | C28H31F2N3O2S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-[3-[[5-(3-cyclopropylsulfanylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2-difluoroethanol |
| SMILES | CCN(CCCOc1ccc(-c2cccc(SC3CC3)c2)c2c1[nH]c1ncc(C)cc12)C(F)(F)CO |
| InChI | InChI=1S/C28H31F2N3O2S/c1-3-33(28(29,30)17-34)12-5-13-35-24-11-10-22(19-6-4-7-21(15-19)36-20-8-9-20)25-23-14-18(2)16-31-27(23)32-26(24)25/h4,6-7,10-11,14-16,20,34H,3,5,8-9,12-13,17H2,1-2H3,(H,31,32) |
| InChIKey | GAWDSCGHNUSWCF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|