About 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid
3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 143666511) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid |
| PubChem CID | 143666511 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | COC1=C(C)CCC(S(=O)(=O)O)=C1 |
| InChI | InChI=1S/C8H12O4S/c1-6-3-4-7(13(9,10)11)5-8(6)12-2/h5H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | VSJHXMUDIRRKSL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid?
The IUPAC name of 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid (CID 143666511) is 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid.
What is the SMILES notation for 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid?
The canonical SMILES for 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid is COC1=C(C)CCC(S(=O)(=O)O)=C1.
What is the InChIKey of 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid?
The InChIKey is VSJHXMUDIRRKSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c1-6-3-4-7(13(9,10)11)5-8(6)12-2/h5H,3-4H2,1-2H3,(H,9,10,11).
What are the key properties of 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid?
3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid has a molecular weight of 204.25 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-methylcyclohexa-1,3-diene-1-sulfonic acid is sourced from PubChem (CID 143666511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).