About [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine
[3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine (PubChem CID 143667197) has the molecular formula C23H34N2O3S
and a molecular weight of 418.60 g/mol. Its IUPAC name is [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine.
Molecular Properties
| Compound Name | [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine |
| PubChem CID | 143667197 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine |
| SMILES | C1CCNC1.CCC(C)CC(=O)Oc1cccc(S(=O)c2ccccc2)c1.CN |
| InChI | InChI=1S/C18H20O3S.C4H9N.CH5N/c1-3-14(2)12-18(19)21-15-8-7-11-17(13-15)22(20)16-9-5-4-6-10-16;1-2-4-5-3-1;1-2/h4-11,13-14H,3,12H2,1-2H3;5H,1-4H2;2H2,1H3 |
| InChIKey | LVQFNPVMHFZPQF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine?
The IUPAC name of [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine (CID 143667197) is [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine.
What is the SMILES notation for [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine?
The canonical SMILES for [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine is C1CCNC1.CCC(C)CC(=O)Oc1cccc(S(=O)c2ccccc2)c1.CN.
What is the InChIKey of [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine?
The InChIKey is LVQFNPVMHFZPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3S.C4H9N.CH5N/c1-3-14(2)12-18(19)21-15-8-7-11-17(13-15)22(20)16-9-5-4-6-10-16;1-2-4-5-3-1;1-2/h4-11,13-14H,3,12H2,1-2H3;5H,1-4H2;2H2,1H3.
What are the key properties of [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine?
[3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine has a molecular weight of 418.60 g/mol, XLogP of 4.14, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(benzenesulfinyl)phenyl] 3-methylpentanoate;methanamine;pyrrolidine is sourced from PubChem (CID 143667197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).