About 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate
2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate (PubChem CID 14366844) has the molecular formula C30H56O6
and a molecular weight of 512.77 g/mol. Its IUPAC name is 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate |
| PubChem CID | 14366844 |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC |
| InChI | InChI=1S/C30H56O6/c1-8-15-18-24(11-4)27(31)34-21-30(14-7,22-35-28(32)25(12-5)19-16-9-2)23-36-29(33)26(13-6)20-17-10-3/h24-26H,8-23H2,1-7H3 |
| InChIKey | QOOJEEZYYXGPAO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate?
The IUPAC name of 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate (CID 14366844) is 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate.
What is the SMILES notation for 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate?
The canonical SMILES for 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate is CCCCC(CC)C(=O)OCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC.
What is the InChIKey of 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate?
The InChIKey is QOOJEEZYYXGPAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H56O6/c1-8-15-18-24(11-4)27(31)34-21-30(14-7,22-35-28(32)25(12-5)19-16-9-2)23-36-29(33)26(13-6)20-17-10-3/h24-26H,8-23H2,1-7H3.
What are the key properties of 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate?
2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate has a molecular weight of 512.77 g/mol, XLogP of 7.66, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate is sourced from PubChem (CID 14366844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).