About 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane
2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane (PubChem CID 143668889) has the molecular formula C18H28ClNO
and a molecular weight of 309.88 g/mol. Its IUPAC name is 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane.
Molecular Properties
| Compound Name | 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane |
| PubChem CID | 143668889 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane |
| SMILES | C.CC.CCC1CCN(c2cc(C=C=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H18ClNO.C2H6.CH4/c1-2-12-5-8-17(9-6-12)15-11-13(7-10-18)3-4-14(15)16;1-2;/h3-4,7,11-12H,2,5-6,8-9H2,1H3;1-2H3;1H4 |
| InChIKey | RZQCSAFDSFOCPU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane?
The IUPAC name of 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane (CID 143668889) is 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane.
What is the SMILES notation for 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane?
The canonical SMILES for 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane is C.CC.CCC1CCN(c2cc(C=C=O)ccc2Cl)CC1.
What is the InChIKey of 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane?
The InChIKey is RZQCSAFDSFOCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO.C2H6.CH4/c1-2-12-5-8-17(9-6-12)15-11-13(7-10-18)3-4-14(15)16;1-2;/h3-4,7,11-12H,2,5-6,8-9H2,1H3;1-2H3;1H4.
What are the key properties of 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane?
2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane has a molecular weight of 309.88 g/mol, XLogP of 5.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-3-(4-ethylpiperidin-1-yl)phenyl]ethenone;ethane;methane is sourced from PubChem (CID 143668889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).