C16H19ClO2 — CID 143668944
8-chloro-7-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one;propane (PubChem CID 143668944) has the molecular formula C16H19ClO2 and a molecular weight of 278.78 g/mol. Its IUPAC name is 8-chloro-7-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one;propane.
| Compound Name | 8-chloro-7-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one;propane |
|---|---|
| PubChem CID | 143668944 |
| Molecular Formula | C16H19ClO2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 8-chloro-7-hydroxy-1,2,9,9a-tetrahydrofluoren-3-one;propane |
| SMILES | CCC.O=C1C=C2c3ccc(O)c(Cl)c3CC2CC1 |
| InChI | InChI=1S/C13H11ClO2.C3H8/c14-13-11-5-7-1-2-8(15)6-10(7)9(11)3-4-12(13)16;1-3-2/h3-4,6-7,16H,1-2,5H2;3H2,1-2H3 |
| InChIKey | XTDRCYVGGMQWLS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |