About ethane;6-ethyl-1H-pyrazin-2-one
ethane;6-ethyl-1H-pyrazin-2-one (PubChem CID 143669024) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is ethane;6-ethyl-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | ethane;6-ethyl-1H-pyrazin-2-one |
| PubChem CID | 143669024 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;6-ethyl-1H-pyrazin-2-one |
| SMILES | CC.CC.CCc1cncc(=O)[nH]1 |
| InChI | InChI=1S/C6H8N2O.2C2H6/c1-2-5-3-7-4-6(9)8-5;2*1-2/h3-4H,2H2,1H3,(H,8,9);2*1-2H3 |
| InChIKey | CEBWXRBBZURTDL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-ethyl-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethyl-1H-pyrazin-2-one?
The IUPAC name of ethane;6-ethyl-1H-pyrazin-2-one (CID 143669024) is ethane;6-ethyl-1H-pyrazin-2-one.
What is the SMILES notation for ethane;6-ethyl-1H-pyrazin-2-one?
The canonical SMILES for ethane;6-ethyl-1H-pyrazin-2-one is CC.CC.CCc1cncc(=O)[nH]1.
What is the InChIKey of ethane;6-ethyl-1H-pyrazin-2-one?
The InChIKey is CEBWXRBBZURTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.2C2H6/c1-2-5-3-7-4-6(9)8-5;2*1-2/h3-4H,2H2,1H3,(H,8,9);2*1-2H3.
What are the key properties of ethane;6-ethyl-1H-pyrazin-2-one?
ethane;6-ethyl-1H-pyrazin-2-one has a molecular weight of 184.28 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethyl-1H-pyrazin-2-one is sourced from PubChem (CID 143669024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).