C14H14F5NO — CID 14366956
(E,E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hept-2-en-1-imine (PubChem CID 14366956) has the molecular formula C14H14F5NO and a molecular weight of 307.26 g/mol. Its IUPAC name is (E,E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hept-2-en-1-imine.
| Compound Name | (E,E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hept-2-en-1-imine |
|---|---|
| PubChem CID | 14366956 |
| Molecular Formula | C14H14F5NO |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (E,E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hept-2-en-1-imine |
| SMILES | CCCC/C=C/C=N/OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H14F5NO/c1-2-3-4-5-6-7-20-21-8-9-10(15)12(17)14(19)13(18)11(9)16/h5-7H,2-4,8H2,1H3/b6-5+,20-7+ |
| InChIKey | PEYJSQOBEFLESI-RGQKVHTQSA-N |
| XLogP | 4.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|