C30H28ClNO3S — CID 143670493
3-chloro-N-cyclohexyl-N-[[5-(4-formylphenyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 143670493) has the molecular formula C30H28ClNO3S and a molecular weight of 518.08 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-N-[[5-(4-formylphenyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-cyclohexyl-N-[[5-(4-formylphenyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143670493 |
| Molecular Formula | C30H28ClNO3S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 3-chloro-N-cyclohexyl-N-[[5-(4-formylphenyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C=O)cc2)cc1CN(C(=O)c1sc2ccccc2c1Cl)C1CCCCC1 |
| InChI | InChI=1S/C30H28ClNO3S/c1-35-26-16-15-22(21-13-11-20(19-33)12-14-21)17-23(26)18-32(24-7-3-2-4-8-24)30(34)29-28(31)25-9-5-6-10-27(25)36-29/h5-6,9-17,19,24H,2-4,7-8,18H2,1H3 |
| InChIKey | XMUAPUFPDVKWPO-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|