C24H25N5OS — CID 143670832
3-(4-amino-3-methanimidoylphenyl)-2,3-diphenyl-N-(1,3,4-thiadiazol-2-yl)propanamide;molecular hydrogen (PubChem CID 143670832) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 3-(4-amino-3-methanimidoylphenyl)-2,3-diphenyl-N-(1,3,4-thiadiazol-2-yl)propanamide;molecular hydrogen.
| Compound Name | 3-(4-amino-3-methanimidoylphenyl)-2,3-diphenyl-N-(1,3,4-thiadiazol-2-yl)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 143670832 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-(4-amino-3-methanimidoylphenyl)-2,3-diphenyl-N-(1,3,4-thiadiazol-2-yl)propanamide;molecular hydrogen |
| SMILES | [H]/N=C/c1cc(C(c2ccccc2)C(C(=O)Nc2nncs2)c2ccccc2)ccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C24H21N5OS.2H2/c25-14-19-13-18(11-12-20(19)26)21(16-7-3-1-4-8-16)22(17-9-5-2-6-10-17)23(30)28-24-29-27-15-31-24;;/h1-15,21-22,25H,26H2,(H,28,29,30);2*1H/b25-14+;; |
| InChIKey | ITSCPTXEVWGNJH-OGTSOACOSA-N |
| XLogP | 5.16 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|