C24H35FN4 — CID 143670872
4-[1-(2,2-dimethylhydrazinyl)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline (PubChem CID 143670872) has the molecular formula C24H35FN4 and a molecular weight of 398.57 g/mol. Its IUPAC name is 4-[1-(2,2-dimethylhydrazinyl)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline.
| Compound Name | 4-[1-(2,2-dimethylhydrazinyl)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 143670872 |
| Molecular Formula | C24H35FN4 |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 4-[1-(2,2-dimethylhydrazinyl)-2,2,5-trimethylhexan-3-yl]-N-(4-fluorophenyl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(C(CC(C)C)C(C)(C)CNN(C)C)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H35FN4/c1-17(2)13-22(24(3,4)16-27-29(5)6)18-7-12-23(19(14-18)15-26)28-21-10-8-20(25)9-11-21/h7-12,14-15,17,22,26-28H,13,16H2,1-6H3/b26-15+ |
| InChIKey | GYXBVFJDWOEILF-CVKSISIWSA-N |
| XLogP | 5.79 |
| TPSA | 51.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|