C14H14BrFO2S — CID 143670996
(2S,3R,4E)-3-(5-bromothiophen-2-yl)-4-ethenyl-6-fluoro-2-methylhepta-4,6-dienoic acid (PubChem CID 143670996) has the molecular formula C14H14BrFO2S and a molecular weight of 345.23 g/mol. Its IUPAC name is (2S,3R,4E)-3-(5-bromothiophen-2-yl)-4-ethenyl-6-fluoro-2-methylhepta-4,6-dienoic acid.
| Compound Name | (2S,3R,4E)-3-(5-bromothiophen-2-yl)-4-ethenyl-6-fluoro-2-methylhepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 143670996 |
| Molecular Formula | C14H14BrFO2S |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | (2S,3R,4E)-3-(5-bromothiophen-2-yl)-4-ethenyl-6-fluoro-2-methylhepta-4,6-dienoic acid |
| SMILES | C=C/C(=C\C(=C)F)[C@H](c1ccc(Br)s1)[C@H](C)C(=O)O |
| InChI | InChI=1S/C14H14BrFO2S/c1-4-10(7-8(2)16)13(9(3)14(17)18)11-5-6-12(15)19-11/h4-7,9,13H,1-2H2,3H3,(H,17,18)/b10-7+/t9-,13+/m0/s1 |
| InChIKey | QVAROWLNFWZCQH-UIJZBTPISA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|