C17H29N2O4P — CID 143671437
(2S)-N-cyclopropyl-1-(3-prop-2-enylphosphanylpropanoyl)pyrrolidine-2-carboxamide;ethene;formic acid (PubChem CID 143671437) has the molecular formula C17H29N2O4P and a molecular weight of 356.40 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-1-(3-prop-2-enylphosphanylpropanoyl)pyrrolidine-2-carboxamide;ethene;formic acid.
| Compound Name | (2S)-N-cyclopropyl-1-(3-prop-2-enylphosphanylpropanoyl)pyrrolidine-2-carboxamide;ethene;formic acid |
|---|---|
| PubChem CID | 143671437 |
| Molecular Formula | C17H29N2O4P |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (2S)-N-cyclopropyl-1-(3-prop-2-enylphosphanylpropanoyl)pyrrolidine-2-carboxamide;ethene;formic acid |
| SMILES | C=C.C=CCPCCC(=O)N1CCC[C@H]1C(=O)NC1CC1.O=CO |
| InChI | InChI=1S/C14H23N2O2P.C2H4.CH2O2/c1-2-9-19-10-7-13(17)16-8-3-4-12(16)14(18)15-11-5-6-11;1-2;2-1-3/h2,11-12,19H,1,3-10H2,(H,15,18);1-2H2;1H,(H,2,3)/t12-;;/m0../s1 |
| InChIKey | PCEFUWLFJVQYGF-LTCKWSDVSA-N |
| XLogP | 2.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|