C27H28N2O5 — CID 14367196
benzyl (2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (PubChem CID 14367196) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 14367196 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O5/c1-20(26(31)33-18-22-13-7-3-8-14-22)28-25(30)24(17-21-11-5-2-6-12-21)29-27(32)34-19-23-15-9-4-10-16-23/h2-16,20,24H,17-19H2,1H3,(H,28,30)(H,29,32)/t20-,24-/m0/s1 |
| InChIKey | LVUGIFZELWWKLR-RDPSFJRHSA-N |
| XLogP | 3.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |